2-{2-[(2-chlorophenyl)methylidene]-3-oxo-2,3-dihydro-4H-1,4-benzoxazin-4-yl}-N-cyclohexylacetamide
Chemical Structure Depiction of
2-{2-[(2-chlorophenyl)methylidene]-3-oxo-2,3-dihydro-4H-1,4-benzoxazin-4-yl}-N-cyclohexylacetamide
2-{2-[(2-chlorophenyl)methylidene]-3-oxo-2,3-dihydro-4H-1,4-benzoxazin-4-yl}-N-cyclohexylacetamide
Compound characteristics
| Compound ID: | C311-0947 |
| Compound Name: | 2-{2-[(2-chlorophenyl)methylidene]-3-oxo-2,3-dihydro-4H-1,4-benzoxazin-4-yl}-N-cyclohexylacetamide |
| Molecular Weight: | 410.9 |
| Molecular Formula: | C23 H23 Cl N2 O3 |
| Smiles: | C1CCC(CC1)NC(CN1C(/C(=C\c2ccccc2[Cl])Oc2ccccc12)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.7245 |
| logD: | 4.7245 |
| logSw: | -4.8669 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 47.229 |
| InChI Key: | OFBACEXPLNOUSH-UHFFFAOYSA-N |