N-[(2-chlorophenyl)methyl]-2-{2-[(2-fluorophenyl)methylidene]-3-oxo-2,3-dihydro-4H-1,4-benzothiazin-4-yl}acetamide
Chemical Structure Depiction of
N-[(2-chlorophenyl)methyl]-2-{2-[(2-fluorophenyl)methylidene]-3-oxo-2,3-dihydro-4H-1,4-benzothiazin-4-yl}acetamide
N-[(2-chlorophenyl)methyl]-2-{2-[(2-fluorophenyl)methylidene]-3-oxo-2,3-dihydro-4H-1,4-benzothiazin-4-yl}acetamide
Compound characteristics
| Compound ID: | C312-0440 |
| Compound Name: | N-[(2-chlorophenyl)methyl]-2-{2-[(2-fluorophenyl)methylidene]-3-oxo-2,3-dihydro-4H-1,4-benzothiazin-4-yl}acetamide |
| Molecular Weight: | 452.93 |
| Molecular Formula: | C24 H18 Cl F N2 O2 S |
| Smiles: | C(c1ccccc1[Cl])NC(CN1C(/C(=C/c2ccccc2F)Sc2ccccc12)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.6065 |
| logD: | 5.6065 |
| logSw: | -5.8708 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.541 |
| InChI Key: | AALNFUYVQBSWIZ-UHFFFAOYSA-N |