N-(2-ethoxyphenyl)-2-(1-methyl-1H-indol-3-yl)acetamide
Chemical Structure Depiction of
N-(2-ethoxyphenyl)-2-(1-methyl-1H-indol-3-yl)acetamide
N-(2-ethoxyphenyl)-2-(1-methyl-1H-indol-3-yl)acetamide
Compound characteristics
| Compound ID: | C320-0324 |
| Compound Name: | N-(2-ethoxyphenyl)-2-(1-methyl-1H-indol-3-yl)acetamide |
| Molecular Weight: | 308.38 |
| Molecular Formula: | C19 H20 N2 O2 |
| Smiles: | CCOc1ccccc1NC(Cc1cn(C)c2ccccc12)=O |
| Stereo: | ACHIRAL |
| logP: | 3.4726 |
| logD: | 3.4724 |
| logSw: | -3.4673 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 32.188 |
| InChI Key: | IVEUMXQNAAIMFF-UHFFFAOYSA-N |