5,7-dimethyl-2-phenyl-N-[4-(propan-2-yl)phenyl]imidazo[1,2-a]pyrimidin-3-amine
Chemical Structure Depiction of
5,7-dimethyl-2-phenyl-N-[4-(propan-2-yl)phenyl]imidazo[1,2-a]pyrimidin-3-amine
5,7-dimethyl-2-phenyl-N-[4-(propan-2-yl)phenyl]imidazo[1,2-a]pyrimidin-3-amine
Compound characteristics
| Compound ID: | C325-0181 |
| Compound Name: | 5,7-dimethyl-2-phenyl-N-[4-(propan-2-yl)phenyl]imidazo[1,2-a]pyrimidin-3-amine |
| Molecular Weight: | 356.47 |
| Molecular Formula: | C23 H24 N4 |
| Smiles: | CC(C)c1ccc(cc1)Nc1c(c2ccccc2)nc2nc(C)cc(C)n12 |
| Stereo: | ACHIRAL |
| logP: | 5.5874 |
| logD: | 5.5767 |
| logSw: | -5.7321 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 27.1731 |
| InChI Key: | OEKXLGXUKMXCPM-UHFFFAOYSA-N |