N-(2,6-dimethylphenyl)-5,7-dimethyl-2-[4-(methylsulfanyl)phenyl]imidazo[1,2-a]pyrimidin-3-amine
Chemical Structure Depiction of
N-(2,6-dimethylphenyl)-5,7-dimethyl-2-[4-(methylsulfanyl)phenyl]imidazo[1,2-a]pyrimidin-3-amine
N-(2,6-dimethylphenyl)-5,7-dimethyl-2-[4-(methylsulfanyl)phenyl]imidazo[1,2-a]pyrimidin-3-amine
Compound characteristics
| Compound ID: | C325-0388 |
| Compound Name: | N-(2,6-dimethylphenyl)-5,7-dimethyl-2-[4-(methylsulfanyl)phenyl]imidazo[1,2-a]pyrimidin-3-amine |
| Molecular Weight: | 388.53 |
| Molecular Formula: | C23 H24 N4 S |
| Smiles: | Cc1cccc(C)c1Nc1c(c2ccc(cc2)SC)nc2nc(C)cc(C)n12 |
| Stereo: | ACHIRAL |
| logP: | 5.1992 |
| logD: | 5.1885 |
| logSw: | -5.1941 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 25.7775 |
| InChI Key: | KYYVAWKNDLZQTP-UHFFFAOYSA-N |