N-(3,4-dimethylphenyl)-2-[4-(morpholin-4-yl)phenyl]imidazo[1,2-a]pyrimidin-3-amine
Chemical Structure Depiction of
N-(3,4-dimethylphenyl)-2-[4-(morpholin-4-yl)phenyl]imidazo[1,2-a]pyrimidin-3-amine
N-(3,4-dimethylphenyl)-2-[4-(morpholin-4-yl)phenyl]imidazo[1,2-a]pyrimidin-3-amine
Compound characteristics
| Compound ID: | C325-0488 |
| Compound Name: | N-(3,4-dimethylphenyl)-2-[4-(morpholin-4-yl)phenyl]imidazo[1,2-a]pyrimidin-3-amine |
| Molecular Weight: | 399.49 |
| Molecular Formula: | C24 H25 N5 O |
| Smiles: | Cc1ccc(cc1C)Nc1c(c2ccc(cc2)N2CCOCC2)nc2ncccn12 |
| Stereo: | ACHIRAL |
| logP: | 4.1829 |
| logD: | 4.1809 |
| logSw: | -4.1747 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.516 |
| InChI Key: | BHHCPMKJXHGTDO-UHFFFAOYSA-N |