N-(3-chloro-4-methylphenyl)-2-(thiophen-3-yl)imidazo[1,2-a]pyrimidin-3-amine
Chemical Structure Depiction of
N-(3-chloro-4-methylphenyl)-2-(thiophen-3-yl)imidazo[1,2-a]pyrimidin-3-amine
N-(3-chloro-4-methylphenyl)-2-(thiophen-3-yl)imidazo[1,2-a]pyrimidin-3-amine
Compound characteristics
| Compound ID: | C325-0561 |
| Compound Name: | N-(3-chloro-4-methylphenyl)-2-(thiophen-3-yl)imidazo[1,2-a]pyrimidin-3-amine |
| Molecular Weight: | 340.83 |
| Molecular Formula: | C17 H13 Cl N4 S |
| Smiles: | Cc1ccc(cc1[Cl])Nc1c(c2ccsc2)nc2ncccn12 |
| Stereo: | ACHIRAL |
| logP: | 4.7049 |
| logD: | 4.7039 |
| logSw: | -5.0038 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 29.1732 |
| InChI Key: | XWNKEGVFQCKGOR-UHFFFAOYSA-N |