methyl 5-[({5-[(3,4,5-trimethoxybenzamido)methyl]-1,3,4-oxadiazol-2-yl}sulfanyl)methyl]furan-2-carboxylate
Chemical Structure Depiction of
methyl 5-[({5-[(3,4,5-trimethoxybenzamido)methyl]-1,3,4-oxadiazol-2-yl}sulfanyl)methyl]furan-2-carboxylate
methyl 5-[({5-[(3,4,5-trimethoxybenzamido)methyl]-1,3,4-oxadiazol-2-yl}sulfanyl)methyl]furan-2-carboxylate
Compound characteristics
| Compound ID: | C328-0129 |
| Compound Name: | methyl 5-[({5-[(3,4,5-trimethoxybenzamido)methyl]-1,3,4-oxadiazol-2-yl}sulfanyl)methyl]furan-2-carboxylate |
| Molecular Weight: | 463.46 |
| Molecular Formula: | C20 H21 N3 O8 S |
| Smiles: | COC(c1ccc(CSc2nnc(CNC(c3cc(c(c(c3)OC)OC)OC)=O)o2)o1)=O |
| Stereo: | ACHIRAL |
| logP: | 1.9856 |
| logD: | 1.9856 |
| logSw: | -2.6174 |
| Hydrogen bond acceptors count: | 13 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 106.408 |
| InChI Key: | QOZPLFKUBXWRSK-UHFFFAOYSA-N |