N-[(5-{[2-(3,5-dimethylanilino)-2-oxoethyl]sulfanyl}-1,3,4-oxadiazol-2-yl)methyl]-2-fluorobenzamide
Chemical Structure Depiction of
N-[(5-{[2-(3,5-dimethylanilino)-2-oxoethyl]sulfanyl}-1,3,4-oxadiazol-2-yl)methyl]-2-fluorobenzamide
N-[(5-{[2-(3,5-dimethylanilino)-2-oxoethyl]sulfanyl}-1,3,4-oxadiazol-2-yl)methyl]-2-fluorobenzamide
Compound characteristics
| Compound ID: | C328-0277 |
| Compound Name: | N-[(5-{[2-(3,5-dimethylanilino)-2-oxoethyl]sulfanyl}-1,3,4-oxadiazol-2-yl)methyl]-2-fluorobenzamide |
| Molecular Weight: | 414.46 |
| Molecular Formula: | C20 H19 F N4 O3 S |
| Smiles: | Cc1cc(C)cc(c1)NC(CSc1nnc(CNC(c2ccccc2F)=O)o1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.1191 |
| logD: | 3.119 |
| logSw: | -3.5671 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 77.564 |
| InChI Key: | CDWQVEOLDXEVBP-UHFFFAOYSA-N |