2-fluoro-N-[(5-{[2-(3-fluoroanilino)-2-oxoethyl]sulfanyl}-1,3,4-oxadiazol-2-yl)methyl]benzamide
Chemical Structure Depiction of
2-fluoro-N-[(5-{[2-(3-fluoroanilino)-2-oxoethyl]sulfanyl}-1,3,4-oxadiazol-2-yl)methyl]benzamide
2-fluoro-N-[(5-{[2-(3-fluoroanilino)-2-oxoethyl]sulfanyl}-1,3,4-oxadiazol-2-yl)methyl]benzamide
Compound characteristics
| Compound ID: | C328-0293 |
| Compound Name: | 2-fluoro-N-[(5-{[2-(3-fluoroanilino)-2-oxoethyl]sulfanyl}-1,3,4-oxadiazol-2-yl)methyl]benzamide |
| Molecular Weight: | 404.39 |
| Molecular Formula: | C18 H14 F2 N4 O3 S |
| Smiles: | C(c1nnc(o1)SCC(Nc1cccc(c1)F)=O)NC(c1ccccc1F)=O |
| Stereo: | ACHIRAL |
| logP: | 2.5795 |
| logD: | 2.5794 |
| logSw: | -3.3132 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 77.564 |
| InChI Key: | JDJOWWUQSODWAM-UHFFFAOYSA-N |