N-[(furan-2-yl)methyl]-2-{[2-(4-methoxyphenyl)-5-(4-methylphenyl)-1H-imidazol-4-yl]sulfanyl}acetamide
Chemical Structure Depiction of
N-[(furan-2-yl)methyl]-2-{[2-(4-methoxyphenyl)-5-(4-methylphenyl)-1H-imidazol-4-yl]sulfanyl}acetamide
N-[(furan-2-yl)methyl]-2-{[2-(4-methoxyphenyl)-5-(4-methylphenyl)-1H-imidazol-4-yl]sulfanyl}acetamide
Compound characteristics
| Compound ID: | C331-0404 |
| Compound Name: | N-[(furan-2-yl)methyl]-2-{[2-(4-methoxyphenyl)-5-(4-methylphenyl)-1H-imidazol-4-yl]sulfanyl}acetamide |
| Molecular Weight: | 433.53 |
| Molecular Formula: | C24 H23 N3 O3 S |
| Smiles: | Cc1ccc(cc1)c1c(nc(c2ccc(cc2)OC)[nH]1)SCC(NCc1ccco1)=O |
| Stereo: | ACHIRAL |
| logP: | 5.5817 |
| logD: | 5.5815 |
| logSw: | -5.3866 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 59.679 |
| InChI Key: | VFVVIOXJCVKBFH-UHFFFAOYSA-N |