2-{[2-(4-fluorophenyl)-5-(4-methylphenyl)-1H-imidazol-4-yl]sulfanyl}-N-(2-methoxyethyl)acetamide
Chemical Structure Depiction of
2-{[2-(4-fluorophenyl)-5-(4-methylphenyl)-1H-imidazol-4-yl]sulfanyl}-N-(2-methoxyethyl)acetamide
2-{[2-(4-fluorophenyl)-5-(4-methylphenyl)-1H-imidazol-4-yl]sulfanyl}-N-(2-methoxyethyl)acetamide
Compound characteristics
| Compound ID: | C331-1363 |
| Compound Name: | 2-{[2-(4-fluorophenyl)-5-(4-methylphenyl)-1H-imidazol-4-yl]sulfanyl}-N-(2-methoxyethyl)acetamide |
| Molecular Weight: | 399.49 |
| Molecular Formula: | C21 H22 F N3 O2 S |
| Smiles: | Cc1ccc(cc1)c1c(nc(c2ccc(cc2)F)[nH]1)SCC(NCCOC)=O |
| Stereo: | ACHIRAL |
| logP: | 4.2117 |
| logD: | 4.2116 |
| logSw: | -4.1665 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 52.842 |
| InChI Key: | MCBCSZWEURDSGN-UHFFFAOYSA-N |