diethyl 1-[2-(3,4-dimethoxyanilino)-2-oxoethyl]-1H-1,2,3-triazole-4,5-dicarboxylate
Chemical Structure Depiction of
diethyl 1-[2-(3,4-dimethoxyanilino)-2-oxoethyl]-1H-1,2,3-triazole-4,5-dicarboxylate
diethyl 1-[2-(3,4-dimethoxyanilino)-2-oxoethyl]-1H-1,2,3-triazole-4,5-dicarboxylate
Compound characteristics
| Compound ID: | C337-0094 |
| Compound Name: | diethyl 1-[2-(3,4-dimethoxyanilino)-2-oxoethyl]-1H-1,2,3-triazole-4,5-dicarboxylate |
| Molecular Weight: | 406.39 |
| Molecular Formula: | C18 H22 N4 O7 |
| Smiles: | CCOC(c1c(C(=O)OCC)n(CC(Nc2ccc(c(c2)OC)OC)=O)nn1)=O |
| Stereo: | ACHIRAL |
| logP: | 1.1224 |
| logD: | 1.1224 |
| logSw: | -2.289 |
| Hydrogen bond acceptors count: | 12 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 105.892 |
| InChI Key: | WTWVRFLGLUBNMI-UHFFFAOYSA-N |