2-({5-[cyclohexyl(methyl)sulfamoyl]-1H-indol-3-yl}methylidene)-N-(2,3-dimethylphenyl)hydrazine-1-carbothioamide
Chemical Structure Depiction of
2-({5-[cyclohexyl(methyl)sulfamoyl]-1H-indol-3-yl}methylidene)-N-(2,3-dimethylphenyl)hydrazine-1-carbothioamide
2-({5-[cyclohexyl(methyl)sulfamoyl]-1H-indol-3-yl}methylidene)-N-(2,3-dimethylphenyl)hydrazine-1-carbothioamide
Compound characteristics
| Compound ID: | C348-0269 |
| Compound Name: | 2-({5-[cyclohexyl(methyl)sulfamoyl]-1H-indol-3-yl}methylidene)-N-(2,3-dimethylphenyl)hydrazine-1-carbothioamide |
| Molecular Weight: | 497.68 |
| Molecular Formula: | C25 H31 N5 O2 S2 |
| Smiles: | Cc1cccc(c1C)NC(N/N=C/c1c[nH]c2ccc(cc12)S(N(C)C1CCCCC1)(=O)=O)=S |
| Stereo: | ACHIRAL |
| logP: | 6.5632 |
| logD: | 6.5632 |
| logSw: | -5.784 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 73.113 |
| InChI Key: | MMZVLZAQXMLRTK-UHFFFAOYSA-N |