N-(2-ethoxyphenyl)-2-{[1-methyl-5-(piperidine-1-sulfonyl)-1H-indol-3-yl]methylidene}hydrazine-1-carbothioamide
Chemical Structure Depiction of
N-(2-ethoxyphenyl)-2-{[1-methyl-5-(piperidine-1-sulfonyl)-1H-indol-3-yl]methylidene}hydrazine-1-carbothioamide
N-(2-ethoxyphenyl)-2-{[1-methyl-5-(piperidine-1-sulfonyl)-1H-indol-3-yl]methylidene}hydrazine-1-carbothioamide
Compound characteristics
| Compound ID: | C348-0342 |
| Compound Name: | N-(2-ethoxyphenyl)-2-{[1-methyl-5-(piperidine-1-sulfonyl)-1H-indol-3-yl]methylidene}hydrazine-1-carbothioamide |
| Molecular Weight: | 499.65 |
| Molecular Formula: | C24 H29 N5 O3 S2 |
| Smiles: | CCOc1ccccc1NC(N/N=C/c1cn(C)c2ccc(cc12)S(N1CCCCC1)(=O)=O)=S |
| Stereo: | ACHIRAL |
| logP: | 5.1005 |
| logD: | 5.1005 |
| logSw: | -4.7457 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 72.068 |
| InChI Key: | OLICJMBCGOUBNZ-UHFFFAOYSA-N |