N-(3-chloro-2-methylphenyl)-2-{[1-methyl-5-(morpholine-4-sulfonyl)-1H-indol-3-yl]methylidene}hydrazine-1-carbothioamide
Chemical Structure Depiction of
N-(3-chloro-2-methylphenyl)-2-{[1-methyl-5-(morpholine-4-sulfonyl)-1H-indol-3-yl]methylidene}hydrazine-1-carbothioamide
N-(3-chloro-2-methylphenyl)-2-{[1-methyl-5-(morpholine-4-sulfonyl)-1H-indol-3-yl]methylidene}hydrazine-1-carbothioamide
Compound characteristics
| Compound ID: | C348-0420 |
| Compound Name: | N-(3-chloro-2-methylphenyl)-2-{[1-methyl-5-(morpholine-4-sulfonyl)-1H-indol-3-yl]methylidene}hydrazine-1-carbothioamide |
| Molecular Weight: | 506.04 |
| Molecular Formula: | C22 H24 Cl N5 O3 S2 |
| Smiles: | Cc1c(cccc1[Cl])NC(N/N=C\c1cn(C)c2ccc(cc12)S(N1CCOCC1)(=O)=O)=S |
| Stereo: | ACHIRAL |
| logP: | 4.7438 |
| logD: | 4.7438 |
| logSw: | -4.8154 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 72.767 |
| InChI Key: | CHUNBWRZXYHSGE-UHFFFAOYSA-N |