6-fluoro-3-(4-methylphenyl)-1-(3-nitrophenyl)-1H-pyrazolo[4,3-c]quinoline
Chemical Structure Depiction of
6-fluoro-3-(4-methylphenyl)-1-(3-nitrophenyl)-1H-pyrazolo[4,3-c]quinoline
6-fluoro-3-(4-methylphenyl)-1-(3-nitrophenyl)-1H-pyrazolo[4,3-c]quinoline
Compound characteristics
| Compound ID: | C350-0437 |
| Compound Name: | 6-fluoro-3-(4-methylphenyl)-1-(3-nitrophenyl)-1H-pyrazolo[4,3-c]quinoline |
| Molecular Weight: | 398.39 |
| Molecular Formula: | C23 H15 F N4 O2 |
| Smiles: | Cc1ccc(cc1)c1c2cnc3c(cccc3c2n(c2cccc(c2)[N+]([O-])=O)n1)F |
| Stereo: | ACHIRAL |
| logP: | 5.5064 |
| logD: | 5.5064 |
| logSw: | -5.8288 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 56.862 |
| InChI Key: | IHLHNVKLJZQELN-UHFFFAOYSA-N |