1-(2,3-dimethylphenyl)-6,8-difluoro-3-phenyl-1H-pyrazolo[4,3-c]quinoline
Chemical Structure Depiction of
1-(2,3-dimethylphenyl)-6,8-difluoro-3-phenyl-1H-pyrazolo[4,3-c]quinoline
1-(2,3-dimethylphenyl)-6,8-difluoro-3-phenyl-1H-pyrazolo[4,3-c]quinoline
Compound characteristics
| Compound ID: | C350-0531 |
| Compound Name: | 1-(2,3-dimethylphenyl)-6,8-difluoro-3-phenyl-1H-pyrazolo[4,3-c]quinoline |
| Molecular Weight: | 385.41 |
| Molecular Formula: | C24 H17 F2 N3 |
| Smiles: | Cc1cccc(c1C)n1c2c(cnc3c(cc(cc23)F)F)c(c2ccccc2)n1 |
| Stereo: | ACHIRAL |
| logP: | 6.2164 |
| logD: | 6.2164 |
| logSw: | -5.9139 |
| Hydrogen bond acceptors count: | 2 |
| Polar surface area: | 23.1794 |
| InChI Key: | GOVQYDVNMUTIDG-UHFFFAOYSA-N |