2-cyano-N~1~-[3-(ethylsulfanyl)-1,2,4-thiadiazol-5-yl]-3-{4-[2-(4-methoxyphenoxy)ethoxy]phenyl}acrylamide
Chemical Structure Depiction of
2-cyano-N~1~-[3-(ethylsulfanyl)-1,2,4-thiadiazol-5-yl]-3-{4-[2-(4-methoxyphenoxy)ethoxy]phenyl}acrylamide
2-cyano-N~1~-[3-(ethylsulfanyl)-1,2,4-thiadiazol-5-yl]-3-{4-[2-(4-methoxyphenoxy)ethoxy]phenyl}acrylamide
Compound characteristics
| Compound ID: | C354-0918 |
| Compound Name: | 2-cyano-N~1~-[3-(ethylsulfanyl)-1,2,4-thiadiazol-5-yl]-3-{4-[2-(4-methoxyphenoxy)ethoxy]phenyl}acrylamide |
| Molecular Weight: | 482.58 |
| Molecular Formula: | C23 H22 N4 O4 S2 |
| Smiles: | CCSc1nc(NC(C(=C/c2ccc(cc2)OCCOc2ccc(cc2)OC)\C#N)=O)sn1 |
| Stereo: | ACHIRAL |
| logP: | 5.36 |
| logD: | 4.69 |
| logSw: | -6.18 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 207.74 |
| InChI Key: | WJBMXXNCEJWKFA-UHFFFAOYSA-N |