1-(cyclopropanecarbonyl)-N-{3-[ethyl(3-methylphenyl)amino]propyl}-2,3-dihydro-1H-indole-5-sulfonamide
Chemical Structure Depiction of
1-(cyclopropanecarbonyl)-N-{3-[ethyl(3-methylphenyl)amino]propyl}-2,3-dihydro-1H-indole-5-sulfonamide
1-(cyclopropanecarbonyl)-N-{3-[ethyl(3-methylphenyl)amino]propyl}-2,3-dihydro-1H-indole-5-sulfonamide
Compound characteristics
| Compound ID: | C361-0833 |
| Compound Name: | 1-(cyclopropanecarbonyl)-N-{3-[ethyl(3-methylphenyl)amino]propyl}-2,3-dihydro-1H-indole-5-sulfonamide |
| Molecular Weight: | 441.59 |
| Molecular Formula: | C24 H31 N3 O3 S |
| Smiles: | CCN(CCCNS(c1ccc2c(CCN2C(C2CC2)=O)c1)(=O)=O)c1cccc(C)c1 |
| Stereo: | ACHIRAL |
| logP: | 4.358 |
| logD: | 4.3467 |
| logSw: | -4.227 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 61.03 |
| InChI Key: | GWDIBSMWZSHPSC-UHFFFAOYSA-N |