5-amino-1-[2-(2,4-dimethylanilino)-2-oxoethyl]-N-(3-methoxyphenyl)-1H-1,2,3-triazole-4-carboxamide
Chemical Structure Depiction of
5-amino-1-[2-(2,4-dimethylanilino)-2-oxoethyl]-N-(3-methoxyphenyl)-1H-1,2,3-triazole-4-carboxamide
5-amino-1-[2-(2,4-dimethylanilino)-2-oxoethyl]-N-(3-methoxyphenyl)-1H-1,2,3-triazole-4-carboxamide
Compound characteristics
| Compound ID: | C368-0681 |
| Compound Name: | 5-amino-1-[2-(2,4-dimethylanilino)-2-oxoethyl]-N-(3-methoxyphenyl)-1H-1,2,3-triazole-4-carboxamide |
| Molecular Weight: | 394.43 |
| Molecular Formula: | C20 H22 N6 O3 |
| Smiles: | Cc1ccc(c(C)c1)NC(Cn1c(c(C(Nc2cccc(c2)OC)=O)nn1)N)=O |
| Stereo: | ACHIRAL |
| logP: | 2.2378 |
| logD: | 2.2378 |
| logSw: | -2.8028 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 4 |
| Polar surface area: | 99.283 |
| InChI Key: | AMHNGLKDGCRSAV-UHFFFAOYSA-N |