5-{[1-(4-ethoxyphenyl)-1H-pyrrol-2-yl]methylidene}-1-[(furan-2-yl)methyl]-1,3-diazinane-2,4,6-trione
Chemical Structure Depiction of
5-{[1-(4-ethoxyphenyl)-1H-pyrrol-2-yl]methylidene}-1-[(furan-2-yl)methyl]-1,3-diazinane-2,4,6-trione
5-{[1-(4-ethoxyphenyl)-1H-pyrrol-2-yl]methylidene}-1-[(furan-2-yl)methyl]-1,3-diazinane-2,4,6-trione
Compound characteristics
| Compound ID: | C370-1795 |
| Compound Name: | 5-{[1-(4-ethoxyphenyl)-1H-pyrrol-2-yl]methylidene}-1-[(furan-2-yl)methyl]-1,3-diazinane-2,4,6-trione |
| Molecular Weight: | 405.41 |
| Molecular Formula: | C22 H19 N3 O5 |
| Smiles: | CCOc1ccc(cc1)n1cccc1/C=C1/C(NC(N(Cc2ccco2)C1=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.3391 |
| logD: | 3.3095 |
| logSw: | -3.3973 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 71.404 |
| InChI Key: | NNFGSPRFOIRTAS-UHFFFAOYSA-N |