1-(3-chlorobenzene-1-sulfonyl)-2-[2-(4-ethoxyphenyl)ethenyl]-1H-benzimidazole
Chemical Structure Depiction of
1-(3-chlorobenzene-1-sulfonyl)-2-[2-(4-ethoxyphenyl)ethenyl]-1H-benzimidazole
1-(3-chlorobenzene-1-sulfonyl)-2-[2-(4-ethoxyphenyl)ethenyl]-1H-benzimidazole
Compound characteristics
| Compound ID: | C381-0221 |
| Compound Name: | 1-(3-chlorobenzene-1-sulfonyl)-2-[2-(4-ethoxyphenyl)ethenyl]-1H-benzimidazole |
| Molecular Weight: | 438.93 |
| Molecular Formula: | C23 H19 Cl N2 O3 S |
| Smiles: | CCOc1ccc(/C=C/c2nc3ccccc3n2S(c2cccc(c2)[Cl])(=O)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 5.9991 |
| logD: | 5.9991 |
| logSw: | -6.3157 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 44.382 |
| InChI Key: | SYUVCXDGOBEGOL-UHFFFAOYSA-N |