N-{[4-(4-benzylpiperidine-1-carbonyl)phenyl]methyl}-4-methoxybenzene-1-sulfonamide
Chemical Structure Depiction of
N-{[4-(4-benzylpiperidine-1-carbonyl)phenyl]methyl}-4-methoxybenzene-1-sulfonamide
N-{[4-(4-benzylpiperidine-1-carbonyl)phenyl]methyl}-4-methoxybenzene-1-sulfonamide
Compound characteristics
| Compound ID: | C382-0160 |
| Compound Name: | N-{[4-(4-benzylpiperidine-1-carbonyl)phenyl]methyl}-4-methoxybenzene-1-sulfonamide |
| Molecular Weight: | 478.61 |
| Molecular Formula: | C27 H30 N2 O4 S |
| Smiles: | COc1ccc(cc1)S(NCc1ccc(cc1)C(N1CCC(CC1)Cc1ccccc1)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.7595 |
| logD: | 4.7594 |
| logSw: | -4.5441 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 65.917 |
| InChI Key: | URWHQSDNMKCDLJ-UHFFFAOYSA-N |