4-{[(benzenesulfonyl)amino]methyl}-N-[(2H-1,3-benzodioxol-5-yl)methyl]benzamide
Chemical Structure Depiction of
4-{[(benzenesulfonyl)amino]methyl}-N-[(2H-1,3-benzodioxol-5-yl)methyl]benzamide
4-{[(benzenesulfonyl)amino]methyl}-N-[(2H-1,3-benzodioxol-5-yl)methyl]benzamide
Compound characteristics
| Compound ID: | C382-0251 |
| Compound Name: | 4-{[(benzenesulfonyl)amino]methyl}-N-[(2H-1,3-benzodioxol-5-yl)methyl]benzamide |
| Molecular Weight: | 424.47 |
| Molecular Formula: | C22 H20 N2 O5 S |
| Smiles: | C(c1ccc2c(c1)OCO2)NC(c1ccc(CNS(c2ccccc2)(=O)=O)cc1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.1192 |
| logD: | 3.1189 |
| logSw: | -3.4504 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 83.525 |
| InChI Key: | NASWOAOYVKZFKL-UHFFFAOYSA-N |