N-cyclohexyl-4-oxo-6-{[4-(propan-2-yl)phenyl]sulfamoyl}-1,4-dihydroquinoline-3-carboxamide
Chemical Structure Depiction of
N-cyclohexyl-4-oxo-6-{[4-(propan-2-yl)phenyl]sulfamoyl}-1,4-dihydroquinoline-3-carboxamide
N-cyclohexyl-4-oxo-6-{[4-(propan-2-yl)phenyl]sulfamoyl}-1,4-dihydroquinoline-3-carboxamide
Compound characteristics
| Compound ID: | C385-0731 |
| Compound Name: | N-cyclohexyl-4-oxo-6-{[4-(propan-2-yl)phenyl]sulfamoyl}-1,4-dihydroquinoline-3-carboxamide |
| Molecular Weight: | 467.59 |
| Molecular Formula: | C25 H29 N3 O4 S |
| Smiles: | CC(C)c1ccc(cc1)NS(c1ccc2c(c1)C(C(=CN2)C(NC1CCCCC1)=O)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.1122 |
| logD: | 4.0512 |
| logSw: | -4.8641 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 3 |
| Polar surface area: | 89.146 |
| InChI Key: | IXVKOQDTRKXQNX-UHFFFAOYSA-N |