2-(2,4-dimethoxyanilino)-N-[(furan-2-yl)methyl]quinoline-4-carboxamide
Chemical Structure Depiction of
2-(2,4-dimethoxyanilino)-N-[(furan-2-yl)methyl]quinoline-4-carboxamide
2-(2,4-dimethoxyanilino)-N-[(furan-2-yl)methyl]quinoline-4-carboxamide
Compound characteristics
| Compound ID: | C387-0253 |
| Compound Name: | 2-(2,4-dimethoxyanilino)-N-[(furan-2-yl)methyl]quinoline-4-carboxamide |
| Molecular Weight: | 403.44 |
| Molecular Formula: | C23 H21 N3 O4 |
| Smiles: | COc1ccc(c(c1)OC)Nc1cc(C(NCc2ccco2)=O)c2ccccc2n1 |
| Stereo: | ACHIRAL |
| logP: | 5.1327 |
| logD: | 5.1192 |
| logSw: | -5.2084 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 64.687 |
| InChI Key: | KBOPZZXCRGKMTI-UHFFFAOYSA-N |