N-[2-(4-chlorophenyl)ethyl]-2-(2,4-dimethylanilino)quinoline-4-carboxamide
Chemical Structure Depiction of
N-[2-(4-chlorophenyl)ethyl]-2-(2,4-dimethylanilino)quinoline-4-carboxamide
N-[2-(4-chlorophenyl)ethyl]-2-(2,4-dimethylanilino)quinoline-4-carboxamide
Compound characteristics
| Compound ID: | C387-1079 |
| Compound Name: | N-[2-(4-chlorophenyl)ethyl]-2-(2,4-dimethylanilino)quinoline-4-carboxamide |
| Molecular Weight: | 429.95 |
| Molecular Formula: | C26 H24 Cl N3 O |
| Smiles: | Cc1ccc(c(C)c1)Nc1cc(C(NCCc2ccc(cc2)[Cl])=O)c2ccccc2n1 |
| Stereo: | ACHIRAL |
| logP: | 6.6477 |
| logD: | 6.6467 |
| logSw: | -6.1602 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 41.606 |
| InChI Key: | PAPIPTCBSXDMHK-UHFFFAOYSA-N |