N-cyclohexyl-N-[(1H-indol-3-yl)methyl]-N'-(4-methoxyphenyl)thiourea
Chemical Structure Depiction of
N-cyclohexyl-N-[(1H-indol-3-yl)methyl]-N'-(4-methoxyphenyl)thiourea
N-cyclohexyl-N-[(1H-indol-3-yl)methyl]-N'-(4-methoxyphenyl)thiourea
Compound characteristics
| Compound ID: | C388-0191 |
| Compound Name: | N-cyclohexyl-N-[(1H-indol-3-yl)methyl]-N'-(4-methoxyphenyl)thiourea |
| Molecular Weight: | 393.55 |
| Molecular Formula: | C23 H27 N3 O S |
| Smiles: | COc1ccc(cc1)NC(N(Cc1c[nH]c2ccccc12)C1CCCCC1)=S |
| Stereo: | ACHIRAL |
| logP: | 5.8863 |
| logD: | 5.8863 |
| logSw: | -5.7851 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 27.0871 |
| InChI Key: | PYNGABVKTGJHAU-UHFFFAOYSA-N |