N-cycloheptyl-N'-(2,4-dimethylphenyl)-N-[(1-methyl-1H-indol-3-yl)methyl]thiourea
Chemical Structure Depiction of
N-cycloheptyl-N'-(2,4-dimethylphenyl)-N-[(1-methyl-1H-indol-3-yl)methyl]thiourea
N-cycloheptyl-N'-(2,4-dimethylphenyl)-N-[(1-methyl-1H-indol-3-yl)methyl]thiourea
Compound characteristics
| Compound ID: | C388-0426 |
| Compound Name: | N-cycloheptyl-N'-(2,4-dimethylphenyl)-N-[(1-methyl-1H-indol-3-yl)methyl]thiourea |
| Molecular Weight: | 419.63 |
| Molecular Formula: | C26 H33 N3 S |
| Smiles: | Cc1ccc(c(C)c1)NC(N(Cc1cn(C)c2ccccc12)C1CCCCCC1)=S |
| Stereo: | ACHIRAL |
| logP: | 7.288 |
| logD: | 7.288 |
| logSw: | -5.7661 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 11.8653 |
| InChI Key: | KSBFTLUIDZFEBK-UHFFFAOYSA-N |