N'-(2-chloro-4-methylphenyl)-N-methyl-N-[(1-methyl-1H-indol-3-yl)methyl]thiourea
Chemical Structure Depiction of
N'-(2-chloro-4-methylphenyl)-N-methyl-N-[(1-methyl-1H-indol-3-yl)methyl]thiourea
N'-(2-chloro-4-methylphenyl)-N-methyl-N-[(1-methyl-1H-indol-3-yl)methyl]thiourea
Compound characteristics
| Compound ID: | C388-0535 |
| Compound Name: | N'-(2-chloro-4-methylphenyl)-N-methyl-N-[(1-methyl-1H-indol-3-yl)methyl]thiourea |
| Molecular Weight: | 357.9 |
| Molecular Formula: | C19 H20 Cl N3 S |
| Smiles: | Cc1ccc(c(c1)[Cl])NC(N(C)Cc1cn(C)c2ccccc12)=S |
| Stereo: | ACHIRAL |
| logP: | 5.023 |
| logD: | 5.023 |
| logSw: | -5.2351 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 12.5006 |
| InChI Key: | RHTXXKOKJUNUTL-UHFFFAOYSA-N |