N-cyclohexyl-N-[(1-ethyl-1H-indol-3-yl)methyl]-N'-(3-methoxyphenyl)urea
Chemical Structure Depiction of
N-cyclohexyl-N-[(1-ethyl-1H-indol-3-yl)methyl]-N'-(3-methoxyphenyl)urea
N-cyclohexyl-N-[(1-ethyl-1H-indol-3-yl)methyl]-N'-(3-methoxyphenyl)urea
Compound characteristics
| Compound ID: | C388-0587 |
| Compound Name: | N-cyclohexyl-N-[(1-ethyl-1H-indol-3-yl)methyl]-N'-(3-methoxyphenyl)urea |
| Molecular Weight: | 405.54 |
| Molecular Formula: | C25 H31 N3 O2 |
| Smiles: | CCn1cc(CN(C2CCCCC2)C(Nc2cccc(c2)OC)=O)c2ccccc12 |
| Stereo: | ACHIRAL |
| logP: | 5.6528 |
| logD: | 5.6528 |
| logSw: | -5.526 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 33.516 |
| InChI Key: | ZJBQDWJRYHMHSY-UHFFFAOYSA-N |