N-(butan-2-yl)-N'-(3-chloro-2-methylphenyl)-N-[(1-ethyl-1H-indol-3-yl)methyl]thiourea
Chemical Structure Depiction of
N-(butan-2-yl)-N'-(3-chloro-2-methylphenyl)-N-[(1-ethyl-1H-indol-3-yl)methyl]thiourea
N-(butan-2-yl)-N'-(3-chloro-2-methylphenyl)-N-[(1-ethyl-1H-indol-3-yl)methyl]thiourea
Compound characteristics
| Compound ID: | C388-0687 |
| Compound Name: | N-(butan-2-yl)-N'-(3-chloro-2-methylphenyl)-N-[(1-ethyl-1H-indol-3-yl)methyl]thiourea |
| Molecular Weight: | 414.01 |
| Molecular Formula: | C23 H28 Cl N3 S |
| Smiles: | CCC(C)N(Cc1cn(CC)c2ccccc12)C(Nc1cccc(c1C)[Cl])=S |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.8361 |
| logD: | 6.8361 |
| logSw: | -6.6617 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 11.0583 |
| InChI Key: | YGVNOZSIKKGQBG-INIZCTEOSA-N |