5-(4-chlorophenyl)-4-(2-fluorophenyl)-3-(4-methylphenyl)-4,5-dihydropyrrolo[3,4-c]pyrazol-6(1H)-one
Chemical Structure Depiction of
5-(4-chlorophenyl)-4-(2-fluorophenyl)-3-(4-methylphenyl)-4,5-dihydropyrrolo[3,4-c]pyrazol-6(1H)-one
5-(4-chlorophenyl)-4-(2-fluorophenyl)-3-(4-methylphenyl)-4,5-dihydropyrrolo[3,4-c]pyrazol-6(1H)-one
Compound characteristics
| Compound ID: | C390-0038 |
| Compound Name: | 5-(4-chlorophenyl)-4-(2-fluorophenyl)-3-(4-methylphenyl)-4,5-dihydropyrrolo[3,4-c]pyrazol-6(1H)-one |
| Molecular Weight: | 417.87 |
| Molecular Formula: | C24 H17 Cl F N3 O |
| Smiles: | Cc1ccc(cc1)c1c2C(c3ccccc3F)N(C(c2[nH]n1)=O)c1ccc(cc1)[Cl] |
| Stereo: | RACEMIC MIXTURE |
| logP: | 5.8923 |
| logD: | 5.8923 |
| logSw: | -6.1585 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 39.527 |
| InChI Key: | CXONKPIYQSPYNP-HSZRJFAPSA-N |