1-(4-ethoxyphenyl)-3-{[(4-methoxyphenyl)methyl]amino}pyrrolidine-2,5-dione
Chemical Structure Depiction of
1-(4-ethoxyphenyl)-3-{[(4-methoxyphenyl)methyl]amino}pyrrolidine-2,5-dione
1-(4-ethoxyphenyl)-3-{[(4-methoxyphenyl)methyl]amino}pyrrolidine-2,5-dione
Compound characteristics
| Compound ID: | C429-0752 |
| Compound Name: | 1-(4-ethoxyphenyl)-3-{[(4-methoxyphenyl)methyl]amino}pyrrolidine-2,5-dione |
| Molecular Weight: | 354.4 |
| Molecular Formula: | C20 H22 N2 O4 |
| Smiles: | CCOc1ccc(cc1)N1C(CC(C1=O)NCc1ccc(cc1)OC)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.326 |
| logD: | 1.3259 |
| logSw: | -2.0458 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.576 |
| InChI Key: | RQPGZVNJXLYENJ-SFHVURJKSA-N |