N-[(2H-1,3-benzodioxol-5-yl)methyl]-5-(morpholin-4-yl)-4-phenylthiophene-2-carboxamide
Chemical Structure Depiction of
N-[(2H-1,3-benzodioxol-5-yl)methyl]-5-(morpholin-4-yl)-4-phenylthiophene-2-carboxamide
N-[(2H-1,3-benzodioxol-5-yl)methyl]-5-(morpholin-4-yl)-4-phenylthiophene-2-carboxamide
Compound characteristics
| Compound ID: | C430-0076 |
| Compound Name: | N-[(2H-1,3-benzodioxol-5-yl)methyl]-5-(morpholin-4-yl)-4-phenylthiophene-2-carboxamide |
| Molecular Weight: | 422.5 |
| Molecular Formula: | C23 H22 N2 O4 S |
| Smiles: | C(c1ccc2c(c1)OCO2)NC(c1cc(c2ccccc2)c(N2CCOCC2)s1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.1931 |
| logD: | 4.1931 |
| logSw: | -4.1712 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.926 |
| InChI Key: | WJOJXJKDLWAESV-UHFFFAOYSA-N |