3-(4-chlorophenoxy)-4-{[(2-methoxyethyl)amino]methyl}-1-(4-methylphenyl)azetidin-2-one--hydrogen chloride (1/1)
Chemical Structure Depiction of
3-(4-chlorophenoxy)-4-{[(2-methoxyethyl)amino]methyl}-1-(4-methylphenyl)azetidin-2-one--hydrogen chloride (1/1)
3-(4-chlorophenoxy)-4-{[(2-methoxyethyl)amino]methyl}-1-(4-methylphenyl)azetidin-2-one--hydrogen chloride (1/1)
Compound characteristics
| Compound ID: | C430-0612 |
| Compound Name: | 3-(4-chlorophenoxy)-4-{[(2-methoxyethyl)amino]methyl}-1-(4-methylphenyl)azetidin-2-one--hydrogen chloride (1/1) |
| Molecular Weight: | 411.33 |
| Molecular Formula: | C20 H23 Cl N2 O3 |
| Salt: | HCl |
| Smiles: | Cc1ccc(cc1)N1C(CNCCOC)C(C1=O)Oc1ccc(cc1)[Cl] |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 2.8537 |
| logD: | 2.6094 |
| logSw: | -3.4694 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 42.235 |
| InChI Key: | TWWVKUGXWDQJDU-UHFFFAOYSA-N |