ethyl 3-[6-ethoxy-3,4-dimethyl-1-(4-methylphenyl)-1H-pyrazolo[3,4-b]pyridin-5-yl]propanoate
Chemical Structure Depiction of
ethyl 3-[6-ethoxy-3,4-dimethyl-1-(4-methylphenyl)-1H-pyrazolo[3,4-b]pyridin-5-yl]propanoate
ethyl 3-[6-ethoxy-3,4-dimethyl-1-(4-methylphenyl)-1H-pyrazolo[3,4-b]pyridin-5-yl]propanoate
Compound characteristics
| Compound ID: | C430-1144 |
| Compound Name: | ethyl 3-[6-ethoxy-3,4-dimethyl-1-(4-methylphenyl)-1H-pyrazolo[3,4-b]pyridin-5-yl]propanoate |
| Molecular Weight: | 381.47 |
| Molecular Formula: | C22 H27 N3 O3 |
| Smiles: | CCOC(CCc1c(C)c2c(C)nn(c3ccc(C)cc3)c2nc1OCC)=O |
| Stereo: | ACHIRAL |
| logP: | 5.1299 |
| logD: | 5.1299 |
| logSw: | -5.1552 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 51.674 |
| InChI Key: | SUWQHNQNAHUEKJ-UHFFFAOYSA-N |