2-cyclohexyl-N-(2,4-dichlorophenyl)-3-oxo-2,3-dihydro-1H-isoindole-4-carboxamide
Chemical Structure Depiction of
2-cyclohexyl-N-(2,4-dichlorophenyl)-3-oxo-2,3-dihydro-1H-isoindole-4-carboxamide
2-cyclohexyl-N-(2,4-dichlorophenyl)-3-oxo-2,3-dihydro-1H-isoindole-4-carboxamide
Compound characteristics
| Compound ID: | C430-5143 |
| Compound Name: | 2-cyclohexyl-N-(2,4-dichlorophenyl)-3-oxo-2,3-dihydro-1H-isoindole-4-carboxamide |
| Molecular Weight: | 403.31 |
| Molecular Formula: | C21 H20 Cl2 N2 O2 |
| Smiles: | C1CCC(CC1)N1Cc2cccc(C(Nc3ccc(cc3[Cl])[Cl])=O)c2C1=O |
| Stereo: | ACHIRAL |
| logP: | 5.334 |
| logD: | 5.0654 |
| logSw: | -6.1239 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 38.666 |
| InChI Key: | OZWDTJGQEJYIKU-UHFFFAOYSA-N |