methyl 3-{[5-(4-fluorophenyl)-4,6-dioxo-4,5,6,6a-tetrahydropyrrolo[3,4-d][1,2,3]triazol-1(3aH)-yl]methyl}-4-methoxybenzoate
Chemical Structure Depiction of
methyl 3-{[5-(4-fluorophenyl)-4,6-dioxo-4,5,6,6a-tetrahydropyrrolo[3,4-d][1,2,3]triazol-1(3aH)-yl]methyl}-4-methoxybenzoate
methyl 3-{[5-(4-fluorophenyl)-4,6-dioxo-4,5,6,6a-tetrahydropyrrolo[3,4-d][1,2,3]triazol-1(3aH)-yl]methyl}-4-methoxybenzoate
Compound characteristics
| Compound ID: | C433-0401 |
| Compound Name: | methyl 3-{[5-(4-fluorophenyl)-4,6-dioxo-4,5,6,6a-tetrahydropyrrolo[3,4-d][1,2,3]triazol-1(3aH)-yl]methyl}-4-methoxybenzoate |
| Molecular Weight: | 412.38 |
| Molecular Formula: | C20 H17 F N4 O5 |
| Smiles: | COC(c1ccc(c(CN2C3C(C(N(C3=O)c3ccc(cc3)F)=O)N=N2)c1)OC)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 1.8545 |
| logD: | 1.8543 |
| logSw: | -2.4369 |
| Hydrogen bond acceptors count: | 10 |
| Polar surface area: | 86.177 |
| InChI Key: | XOUVBDXMTHMARP-UHFFFAOYSA-N |