N-(4-bromo-3-methylphenyl)-N~2~-(3,5-dimethyl-1,2-oxazole-4-sulfonyl)-N~2~-(4-methylphenyl)glycinamide
Chemical Structure Depiction of
N-(4-bromo-3-methylphenyl)-N~2~-(3,5-dimethyl-1,2-oxazole-4-sulfonyl)-N~2~-(4-methylphenyl)glycinamide
N-(4-bromo-3-methylphenyl)-N~2~-(3,5-dimethyl-1,2-oxazole-4-sulfonyl)-N~2~-(4-methylphenyl)glycinamide
Compound characteristics
| Compound ID: | C436-2046 |
| Compound Name: | N-(4-bromo-3-methylphenyl)-N~2~-(3,5-dimethyl-1,2-oxazole-4-sulfonyl)-N~2~-(4-methylphenyl)glycinamide |
| Molecular Weight: | 492.39 |
| Molecular Formula: | C21 H22 Br N3 O4 S |
| Smiles: | Cc1ccc(cc1)N(CC(Nc1ccc(c(C)c1)[Br])=O)S(c1c(C)noc1C)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.416 |
| logD: | 4.4159 |
| logSw: | -4.2346 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 76.98 |
| InChI Key: | BHZVQVUUANTZFO-UHFFFAOYSA-N |