4-acetyl-N-[4-chloro-3-(trifluoromethyl)phenyl]-3,5-dimethyl-1H-pyrrole-2-carboxamide
Chemical Structure Depiction of
4-acetyl-N-[4-chloro-3-(trifluoromethyl)phenyl]-3,5-dimethyl-1H-pyrrole-2-carboxamide
4-acetyl-N-[4-chloro-3-(trifluoromethyl)phenyl]-3,5-dimethyl-1H-pyrrole-2-carboxamide
Compound characteristics
| Compound ID: | C444-0291 |
| Compound Name: | 4-acetyl-N-[4-chloro-3-(trifluoromethyl)phenyl]-3,5-dimethyl-1H-pyrrole-2-carboxamide |
| Molecular Weight: | 358.75 |
| Molecular Formula: | C16 H14 Cl F3 N2 O2 |
| Smiles: | CC(c1c(C)c(C(Nc2ccc(c(c2)C(F)(F)F)[Cl])=O)[nH]c1C)=O |
| Stereo: | ACHIRAL |
| logP: | 4.2022 |
| logD: | 4.0097 |
| logSw: | -4.8317 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 48.138 |
| InChI Key: | JZUZSNKJZNRSDF-UHFFFAOYSA-N |