N-(5-chloro-2-methylphenyl)-3-(4-methoxyphenyl)-N,5-dimethyl-4-oxo-4,5-dihydro-3H-pyridazino[4,5-b]indole-1-carboxamide
Chemical Structure Depiction of
N-(5-chloro-2-methylphenyl)-3-(4-methoxyphenyl)-N,5-dimethyl-4-oxo-4,5-dihydro-3H-pyridazino[4,5-b]indole-1-carboxamide
N-(5-chloro-2-methylphenyl)-3-(4-methoxyphenyl)-N,5-dimethyl-4-oxo-4,5-dihydro-3H-pyridazino[4,5-b]indole-1-carboxamide
Compound characteristics
| Compound ID: | C448-1064 |
| Compound Name: | N-(5-chloro-2-methylphenyl)-3-(4-methoxyphenyl)-N,5-dimethyl-4-oxo-4,5-dihydro-3H-pyridazino[4,5-b]indole-1-carboxamide |
| Molecular Weight: | 486.96 |
| Molecular Formula: | C27 H23 Cl N4 O3 |
| Smiles: | Cc1ccc(cc1N(C)C(C1c2c3ccccc3n(C)c2C(N(c2ccc(cc2)OC)N=1)=O)=O)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 5.0937 |
| logD: | 5.0936 |
| logSw: | -5.6685 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 50.583 |
| InChI Key: | JEGYFZIAINMCNL-UHFFFAOYSA-N |