N-ethyl-N-(4-ethylphenyl)-3-(4-methoxyphenyl)-5-methyl-4-oxo-4,5-dihydro-3H-pyridazino[4,5-b]indole-1-carboxamide
Chemical Structure Depiction of
N-ethyl-N-(4-ethylphenyl)-3-(4-methoxyphenyl)-5-methyl-4-oxo-4,5-dihydro-3H-pyridazino[4,5-b]indole-1-carboxamide
N-ethyl-N-(4-ethylphenyl)-3-(4-methoxyphenyl)-5-methyl-4-oxo-4,5-dihydro-3H-pyridazino[4,5-b]indole-1-carboxamide
Compound characteristics
| Compound ID: | C448-1068 |
| Compound Name: | N-ethyl-N-(4-ethylphenyl)-3-(4-methoxyphenyl)-5-methyl-4-oxo-4,5-dihydro-3H-pyridazino[4,5-b]indole-1-carboxamide |
| Molecular Weight: | 480.57 |
| Molecular Formula: | C29 H28 N4 O3 |
| Smiles: | CCc1ccc(cc1)N(CC)C(C1c2c3ccccc3n(C)c2C(N(c2ccc(cc2)OC)N=1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.4452 |
| logD: | 5.4452 |
| logSw: | -5.6982 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 50.862 |
| InChI Key: | CNCMFQGDIRQFBT-UHFFFAOYSA-N |