3-(4-methoxyphenyl)-5-methyl-N-(3-methylbutyl)-4-oxo-4,5-dihydro-3H-pyridazino[4,5-b]indole-1-carboxamide
Chemical Structure Depiction of
3-(4-methoxyphenyl)-5-methyl-N-(3-methylbutyl)-4-oxo-4,5-dihydro-3H-pyridazino[4,5-b]indole-1-carboxamide
3-(4-methoxyphenyl)-5-methyl-N-(3-methylbutyl)-4-oxo-4,5-dihydro-3H-pyridazino[4,5-b]indole-1-carboxamide
Compound characteristics
| Compound ID: | C448-1104 |
| Compound Name: | 3-(4-methoxyphenyl)-5-methyl-N-(3-methylbutyl)-4-oxo-4,5-dihydro-3H-pyridazino[4,5-b]indole-1-carboxamide |
| Molecular Weight: | 418.49 |
| Molecular Formula: | C24 H26 N4 O3 |
| Smiles: | CC(C)CCNC(C1c2c3ccccc3n(C)c2C(N(c2ccc(cc2)OC)N=1)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.7923 |
| logD: | 3.7923 |
| logSw: | -4.3505 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 60.041 |
| InChI Key: | OEBOSGMZEUIHCW-UHFFFAOYSA-N |