5-methyl-3-(4-methylphenyl)-4-oxo-N-(3,4,5-trimethoxyphenyl)-4,5-dihydro-3H-pyridazino[4,5-b]indole-1-carboxamide
Chemical Structure Depiction of
5-methyl-3-(4-methylphenyl)-4-oxo-N-(3,4,5-trimethoxyphenyl)-4,5-dihydro-3H-pyridazino[4,5-b]indole-1-carboxamide
5-methyl-3-(4-methylphenyl)-4-oxo-N-(3,4,5-trimethoxyphenyl)-4,5-dihydro-3H-pyridazino[4,5-b]indole-1-carboxamide
Compound characteristics
| Compound ID: | C448-1436 |
| Compound Name: | 5-methyl-3-(4-methylphenyl)-4-oxo-N-(3,4,5-trimethoxyphenyl)-4,5-dihydro-3H-pyridazino[4,5-b]indole-1-carboxamide |
| Molecular Weight: | 498.54 |
| Molecular Formula: | C28 H26 N4 O5 |
| Smiles: | Cc1ccc(cc1)N1C(c2c(C(C(Nc3cc(c(c(c3)OC)OC)OC)=O)=N1)c1ccccc1n2C)=O |
| Stereo: | ACHIRAL |
| logP: | 3.9644 |
| logD: | 3.9592 |
| logSw: | -4.3031 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 74.04 |
| InChI Key: | IRCWPWSYVIKCQV-UHFFFAOYSA-N |