N'-(2,4-dimethylphenyl)-N-[2-(5-fluoro-2-methyl-1H-indol-3-yl)ethyl]-N-[(pyridin-2-yl)methyl]thiourea
Chemical Structure Depiction of
N'-(2,4-dimethylphenyl)-N-[2-(5-fluoro-2-methyl-1H-indol-3-yl)ethyl]-N-[(pyridin-2-yl)methyl]thiourea
N'-(2,4-dimethylphenyl)-N-[2-(5-fluoro-2-methyl-1H-indol-3-yl)ethyl]-N-[(pyridin-2-yl)methyl]thiourea
Compound characteristics
| Compound ID: | C449-0013 |
| Compound Name: | N'-(2,4-dimethylphenyl)-N-[2-(5-fluoro-2-methyl-1H-indol-3-yl)ethyl]-N-[(pyridin-2-yl)methyl]thiourea |
| Molecular Weight: | 446.59 |
| Molecular Formula: | C26 H27 F N4 S |
| Smiles: | Cc1ccc(c(C)c1)NC(N(CCc1c2cc(ccc2[nH]c1C)F)Cc1ccccn1)=S |
| Stereo: | ACHIRAL |
| logP: | 5.8702 |
| logD: | 5.8702 |
| logSw: | -5.7381 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 29.1776 |
| InChI Key: | QAVGNPBEVYWNBO-UHFFFAOYSA-N |