N-[2-(5-fluoro-2-methyl-1H-indol-3-yl)ethyl]-N'-(3-fluorophenyl)-N-[(furan-2-yl)methyl]thiourea
Chemical Structure Depiction of
N-[2-(5-fluoro-2-methyl-1H-indol-3-yl)ethyl]-N'-(3-fluorophenyl)-N-[(furan-2-yl)methyl]thiourea
N-[2-(5-fluoro-2-methyl-1H-indol-3-yl)ethyl]-N'-(3-fluorophenyl)-N-[(furan-2-yl)methyl]thiourea
Compound characteristics
| Compound ID: | C449-0043 |
| Compound Name: | N-[2-(5-fluoro-2-methyl-1H-indol-3-yl)ethyl]-N'-(3-fluorophenyl)-N-[(furan-2-yl)methyl]thiourea |
| Molecular Weight: | 425.5 |
| Molecular Formula: | C23 H21 F2 N3 O S |
| Smiles: | Cc1c(CCN(Cc2ccco2)C(Nc2cccc(c2)F)=S)c2cc(ccc2[nH]1)F |
| Stereo: | ACHIRAL |
| logP: | 5.7505 |
| logD: | 5.7505 |
| logSw: | -5.7118 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 28.081 |
| InChI Key: | AULNLCVFUDWYEC-UHFFFAOYSA-N |