N-[2-(5-chloro-2-methyl-1H-indol-3-yl)ethyl]-N'-(3,5-dimethylphenyl)-N-[(pyridin-2-yl)methyl]thiourea
Chemical Structure Depiction of
N-[2-(5-chloro-2-methyl-1H-indol-3-yl)ethyl]-N'-(3,5-dimethylphenyl)-N-[(pyridin-2-yl)methyl]thiourea
N-[2-(5-chloro-2-methyl-1H-indol-3-yl)ethyl]-N'-(3,5-dimethylphenyl)-N-[(pyridin-2-yl)methyl]thiourea
Compound characteristics
| Compound ID: | C449-0060 |
| Compound Name: | N-[2-(5-chloro-2-methyl-1H-indol-3-yl)ethyl]-N'-(3,5-dimethylphenyl)-N-[(pyridin-2-yl)methyl]thiourea |
| Molecular Weight: | 463.04 |
| Molecular Formula: | C26 H27 Cl N4 S |
| Smiles: | Cc1cc(C)cc(c1)NC(N(CCc1c2cc(ccc2[nH]c1C)[Cl])Cc1ccccn1)=S |
| Stereo: | ACHIRAL |
| logP: | 6.3486 |
| logD: | 6.3486 |
| logSw: | -6.2785 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 29.8754 |
| InChI Key: | UTWZZXFQLLVDHZ-UHFFFAOYSA-N |