N'-(2,5-dimethoxyphenyl)-N-[(furan-2-yl)methyl]-N-[2-(2-methyl-1H-indol-3-yl)ethyl]thiourea
Chemical Structure Depiction of
N'-(2,5-dimethoxyphenyl)-N-[(furan-2-yl)methyl]-N-[2-(2-methyl-1H-indol-3-yl)ethyl]thiourea
N'-(2,5-dimethoxyphenyl)-N-[(furan-2-yl)methyl]-N-[2-(2-methyl-1H-indol-3-yl)ethyl]thiourea
Compound characteristics
| Compound ID: | C449-0133 |
| Compound Name: | N'-(2,5-dimethoxyphenyl)-N-[(furan-2-yl)methyl]-N-[2-(2-methyl-1H-indol-3-yl)ethyl]thiourea |
| Molecular Weight: | 449.57 |
| Molecular Formula: | C25 H27 N3 O3 S |
| Smiles: | Cc1c(CCN(Cc2ccco2)C(Nc2cc(ccc2OC)OC)=S)c2ccccc2[nH]1 |
| Stereo: | ACHIRAL |
| logP: | 5.3905 |
| logD: | 5.3905 |
| logSw: | -5.7767 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 42.557 |
| InChI Key: | VNGZUVSCWZHFFM-UHFFFAOYSA-N |